Chemistry·Explained

Important Compounds of Carbon and Silicon — Explained

NEET UG
Version 1Updated 22 Mar 2026

Detailed Explanation

The chemistry of Group 14 elements, particularly carbon and silicon, is incredibly rich and diverse, giving rise to a multitude of compounds with profound significance. Let's delve into the important compounds of these two elements, understanding their preparation, properties, structures, and applications.

Important Compounds of Carbon

Carbon, with its small size, high electronegativity, and unique ability to form strong CCC-C bonds (catenation) and multiple bonds (C=CC=C, CequivCC equiv C, C=OC=O, CequivNC equiv N), forms an astonishing array of compounds. Here, we focus on some key inorganic compounds.

1. Carbon Monoxide (CO)

Carbon monoxide is a colorless, odorless, and highly toxic gas. It's a potent reducing agent and an important industrial chemical.

  • Preparation:

* Laboratory Method: By dehydration of formic acid with concentrated sulfuric acid at 373 K:

HCOOHxrightarrowConc.H2SO4,373KCO+H2OHCOOH xrightarrow{Conc. H_2SO_4, 373 K} CO + H_2O
* Industrial Method: By passing steam over hot coke (carbon) at high temperatures (around 1270 K). This produces 'water gas', a mixture of CO and H2_2:
C(s)+H2O(g)xrightarrow1270KCO(g)+H2(g)C(s) + H_2O(g) xrightarrow{1270 K} CO(g) + H_2(g)
* Also formed by incomplete combustion of carbonaceous fuels.

  • Properties:

* Toxic Nature: CO is extremely poisonous because it binds to hemoglobin in blood about 200-300 times more strongly than oxygen, forming carboxyhemoglobin. This reduces the oxygen-carrying capacity of blood, leading to hypoxia and potentially death.

* Reducing Agent: CO is a powerful reducing agent, especially at high temperatures. It reduces metal oxides to metals, which is crucial in metallurgy (e.g., blast furnace):

Fe2O3(s)+3CO(g)xrightarrowDelta2Fe(s)+3CO2(g)Fe_2O_3(s) + 3CO(g) xrightarrow{Delta} 2Fe(s) + 3CO_2(g)
* Combustion: Burns with a blue flame to form carbon dioxide:
2CO(g)+O2(g)xrightarrowDelta2CO2(g)2CO(g) + O_2(g) xrightarrow{Delta} 2CO_2(g)
* Structure: CO molecule has a triple bond between carbon and oxygen (CequivOC equiv O), with a lone pair on both atoms.

It is a polar molecule with a small dipole moment. Carbon has a formal charge of -1 and oxygen +1, but resonance structures contribute to its stability.

  • Uses:As a reducing agent in metallurgy, in the synthesis of methanol, and as a component of fuel gases (water gas, producer gas).

2. Carbon Dioxide (CO$_2$)

Carbon dioxide is a colorless, odorless gas, slightly acidic, and non-combustible. It is vital for photosynthesis and is a significant greenhouse gas.

  • Preparation:

* Laboratory Method: By the action of dilute acids on metal carbonates (e.g., marble chips):

CaCO3(s)+2HCl(aq)CaCl2(aq)+H2O(l)+CO2(g)CaCO_3(s) + 2HCl(aq) \rightarrow CaCl_2(aq) + H_2O(l) + CO_2(g)
* Industrial Method: By heating limestone (calcium carbonate) in a lime kiln:
CaCO3(s)xrightarrowDeltaCaO(s)+CO2(g)CaCO_3(s) xrightarrow{Delta} CaO(s) + CO_2(g)
* Also produced by the complete combustion of carbonaceous fuels and during fermentation processes.

  • Properties:

* Acidic Nature: Dissolves in water to form carbonic acid (H2CO3H_2CO_3), a weak acid:

CO2(g)+H2O(l)H2CO3(aq)CO_2(g) + H_2O(l) \rightleftharpoons H_2CO_3(aq)
* Greenhouse Gas: Traps infrared radiation, contributing to the greenhouse effect and global warming.

* **Solid CO2_2 (Dry Ice):** Sublimes directly from solid to gas at atmospheric pressure, making it useful as a refrigerant. * Structure: Linear molecule with two C=OC=O double bonds. Carbon is spsp hybridized.

The O=C=OO=C=O bond angle is 180circ180^circ. It is a non-polar molecule despite having polar C=OC=O bonds due to its symmetrical linear structure.

  • Uses:In soft drinks (carbonation), fire extinguishers, as a refrigerant (dry ice), in photosynthesis, and in the manufacture of urea.

3. Carbonates

Carbonates are salts of carbonic acid (H2CO3H_2CO_3), containing the carbonate ion (CO32CO_3^{2-}). They are widespread in nature.

  • Examples:Calcium carbonate (CaCO3CaCO_3) (limestone, marble, chalk), sodium carbonate (Na2CO3Na_2CO_3) (washing soda), sodium bicarbonate (NaHCO3NaHCO_3) (baking soda).
  • Properties:Most metal carbonates are insoluble in water (except alkali metal carbonates and ammonium carbonate). They decompose on heating to give metal oxides and carbon dioxide.
  • Uses:CaCO3CaCO_3 is used in construction, as a flux in metallurgy, and in the manufacture of cement and glass. Na2CO3Na_2CO_3 is used in glass, soap, and paper industries. NaHCO3NaHCO_3 is used as an antacid, in baking, and in fire extinguishers.

4. Carbides

Carbides are binary compounds of carbon with elements of lower or similar electronegativity. They are generally classified into three types:

  • Ionic Carbides (Salt-like Carbides):Formed by highly electropositive metals (Group 1, 2, and Al). They contain C22C_2^{2-} (acetylide) or C4C^{4-} (methanide) ions. E.g., CaC2CaC_2 (calcium carbide) gives acetylene on hydrolysis, and Al4C3Al_4C_3 (aluminum carbide) gives methane.

CaC2(s)+2H2O(l)Ca(OH)2(aq)+C2H2(g)CaC_2(s) + 2H_2O(l) \rightarrow Ca(OH)_2(aq) + C_2H_2(g)
Al4C3(s)+12H2O(l)4Al(OH)3(s)+3CH4(g)Al_4C_3(s) + 12H_2O(l) \rightarrow 4Al(OH)_3(s) + 3CH_4(g)

  • Covalent Carbides:Formed by carbon with elements of similar electronegativity (e.g., SiC, BC). They are very hard and refractory. Silicon carbide (carborundum, SiC) is extremely hard, used as an abrasive.
  • Interstitial Carbides:Formed by transition metals. Carbon atoms occupy interstitial sites in the metal lattice. They are very hard, chemically inert, and have high melting points (e.g., WC, TiC).

Important Compounds of Silicon

Silicon, being larger than carbon and less electronegative, predominantly forms compounds with oxygen, often involving extended covalent networks.

1. Silicon Dioxide (Silica, SiO$_2$)

Silica is the most common compound of silicon and is the primary component of sand, quartz, and many rocks. It exists in various crystalline forms.

  • Structure:Silica is a giant covalent network solid. Each silicon atom is tetrahedrally bonded to four oxygen atoms, and each oxygen atom is bonded to two silicon atoms. This forms a three-dimensional network of SiO4SiO_4 tetrahedra sharing all their corners. The overall formula is SiO2SiO_2, but it's not a discrete molecular unit. This strong network structure accounts for its high melting point, hardness, and chemical inertness.

* Polymorphs: Common crystalline forms include quartz (most stable at room temperature), cristobalite, and tridymite. Amorphous forms include kieselguhr and silica gel.

  • Properties:

* Acidic Oxide: Reacts with strong bases and basic oxides at high temperatures to form silicates:

SiO2(s)+2NaOH(aq)Na2SiO3(aq)+H2O(l)SiO_2(s) + 2NaOH(aq) \rightarrow Na_2SiO_3(aq) + H_2O(l)
SiO2(s)+CaO(s)xrightarrowDeltaCaSiO3(s)SiO_2(s) + CaO(s) xrightarrow{Delta} CaSiO_3(s)
* Unreactive: Highly unreactive towards halogens, hydrogen, and most acids, except hydrofluoric acid (HF):
SiO2(s)+4HF(aq)SiF4(g)+2H2O(l)SiO_2(s) + 4HF(aq) \rightarrow SiF_4(g) + 2H_2O(l)
* High Melting Point and Hardness: Due to the strong, extensive covalent network structure.

  • Uses:In glass manufacturing, ceramics, cement, as an abrasive, in optical instruments (quartz), and as a desiccant (silica gel).

2. Silicones

Silicones are organosilicon polymers containing R2SiOR_2SiO repeating units, where R is an alkyl or aryl group. They are characterized by a silicon-oxygen backbone with organic groups attached to silicon.

  • Preparation:Silicones are synthesized from alkyl or aryl substituted chlorosilanes (RnSiCl4nR_nSiCl_{4-n}). For example, dimethylchlorosilane ((CH3)2SiCl2(CH_3)_2SiCl_2) on hydrolysis forms a silanol, which then polymerizes through condensation to form linear silicones:

(CH3)2SiCl2+2H2O(CH3)2Si(OH)2+2HCl(CH_3)_2SiCl_2 + 2H_2O \rightarrow (CH_3)_2Si(OH)_2 + 2HCl
n(CH3)2Si(OH)2[Si(CH3)2O]n+nH2On(CH_3)_2Si(OH)_2 \rightarrow [-Si(CH_3)_2-O-]_n + nH_2O
The degree of polymerization and cross-linking can be controlled by using mono-, di-, or trichlorosilanes.

  • Properties:

* Water Repellent: Due to the non-polar organic groups attached to the silicon-oxygen backbone. * Thermal Stability: Stable over a wide range of temperatures. * Chemical Inertness: Resistant to oxidation, acids, and bases. * Low Surface Tension: Excellent lubricants. * Electrical Insulators: Good dielectric properties.

  • Uses:As sealants, greases, lubricants, electrical insulators, water-proofing agents, in cosmetics, and in surgical and medical implants.

3. Silicates

Silicates are compounds containing silicon and oxygen, often with other metals, forming a vast class of minerals. The fundamental structural unit of silicates is the SiO44SiO_4^{4-} tetrahedron, where a silicon atom is at the center, surrounded by four oxygen atoms.

  • **Classification based on SiO44SiO_4^{4-} arrangement:**

* Orthosilicates (Nesosilicates): Discrete SiO44SiO_4^{4-} units (e.g., Zircon, ZrSiO4ZrSiO_4). * Pyrosilicates (Sorosilicates): Two SiO44SiO_4^{4-} units sharing one oxygen atom, forming Si2O76Si_2O_7^{6-} (e.

g., Thortveitite, Sc2Si2O7Sc_2Si_2O_7). * Cyclic Silicates (Ring Silicates): SiO44SiO_4^{4-} units form rings by sharing two oxygen atoms each (e.g., Si3O96Si_3O_9^{6-}, Si6O1812Si_6O_{18}^{12-} in Beryl). * Chain Silicates (Inosilicates): SiO44SiO_4^{4-} units link to form single chains (SiO32SiO_3^{2-})n_n (e.

g., Pyroxenes) or double chains (Si4O116Si_4O_{11}^{6-})n_n (e.g., Amphiboles like asbestos). * Sheet Silicates (Phyllosilicates): SiO44SiO_4^{4-} units share three oxygen atoms each, forming two-dimensional sheets (Si2O52Si_2O_5^{2-})n_n (e.

g., Mica, Talc). * Three-Dimensional Network Silicates (Tectosilicates): All four oxygen atoms of each SiO44SiO_4^{4-} tetrahedron are shared with other tetrahedra, forming a 3D network. Examples include quartz (SiO2SiO_2) and feldspars.

If some Si4+Si^{4+} ions are replaced by Al3+Al^{3+} ions, the network becomes negatively charged and is balanced by positive ions like Na+Na^+, K+K^+, Ca2+Ca^{2+} (e.g., Feldspars, Zeolites).

  • Uses:Silicates are the primary components of rocks, ceramics, glass, and cement. Specific silicates like asbestos were historically used for insulation (now largely phased out due to health concerns), and mica is used as an electrical insulator.

4. Zeolites

Zeolites are a special class of aluminosilicates with a three-dimensional network structure where some silicon atoms in the SiO2SiO_2 framework are replaced by aluminum atoms (AlO45AlO_4^{5-}). This substitution creates a negative charge on the framework, which is balanced by cations like Na+Na^+, K+K^+, Ca2+Ca^{2+} located in the pores.

  • Structure:Zeolites have a porous, cage-like structure with well-defined channels and cavities. This unique structure allows them to act as 'molecular sieves', selectively adsorbing molecules based on their size and shape.
  • Properties:

* Molecular Sieves: Can separate molecules based on size and shape. * Ion Exchange: The cations within the zeolite framework can be exchanged with other cations in solution, making them useful in water softening. * Catalytic Properties: The acidic sites within the framework (Brønsted and Lewis acid sites) make them excellent catalysts, especially in petrochemical industries.

  • Uses:In petrochemical industries for cracking hydrocarbons (e.g., ZSM-5 converts alcohols directly into gasoline), as catalysts in various organic reactions, in water softening (e.g., Permutit process), and as desiccants.
Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.