Chemistry·Revision Notes

Anomalous Properties of Lithium and Beryllium — Revision Notes

NEET UG
Version 1Updated 22 Mar 2026

⚡ 30-Second Revision

  • Li Anomalies:Smallest size, highest charge density in Group 1.

- Forms Li2OLi_2O (monoxide) with O2O_2. - Forms Li3NLi_3N (nitride) with N2N_2. - Less vigorous reaction with H2OH_2O. - Li2CO3Li_2CO_3, LiNO3LiNO_3 less thermally stable. - LiClLiCl soluble in organic solvents. - Diagonal relationship with MgMg.

  • Be Anomalies:Smallest size, highest charge density in Group 2.

- Predominantly covalent compounds. - BeOBeO, Be(OH)2Be(OH)_2 are amphoteric. - Maximum covalency of 4 (no d-orbitals). - Does not react with H2OH_2O/steam. - Be2CBe_2C hydrolyzes to CH4CH_4. - Diagonal relationship with AlAl.

  • Reasons:Small size, high charge density, high polarizing power, absence of d-orbitals (for Be).

2-Minute Revision

Lithium (Li) and Beryllium (Be), the first elements of their respective groups, exhibit 'anomalous properties' due to their exceptionally small atomic/ionic sizes, high charge density, and high electronegativity.

Beryllium also lacks vacant d-orbitals. These factors lead to a greater covalent character in their compounds and distinct chemical behaviors. Lithium, unlike other alkali metals, forms a monoxide (Li2OLi_2O) with oxygen and a nitride (Li3NLi_3N) with nitrogen.

Its compounds like Li2CO3Li_2CO_3 and LiNO3LiNO_3 are less thermally stable due to the high polarizing power of Li+Li^+. Beryllium's compounds are predominantly covalent, and its oxide (BeOBeO) and hydroxide (Be(OH)2Be(OH)_2) are amphoteric.

It has a maximum covalency of four, limited by the absence of d-orbitals. Both elements show a 'diagonal relationship': Li resembles Magnesium (Mg), and Be resembles Aluminium (Al), sharing properties like nitride formation (Li-Mg) or amphoteric oxides (Be-Al).

Key for NEET is to remember these specific deviations and their underlying reasons.

5-Minute Revision

The anomalous properties of lithium and beryllium are crucial for NEET, stemming from their unique atomic characteristics. Both elements possess exceptionally small atomic and ionic radii, leading to a very high charge density for their ions (Li+Li^+ and Be2+Be^{2+}).

This high charge density imparts a strong polarizing power, causing their compounds to exhibit significant covalent character, a deviation from the typically ionic nature of other group members. Furthermore, their relatively higher electronegativity contributes to this covalent tendency.

For beryllium, a critical factor is the absence of vacant d-orbitals in its valence shell, limiting its maximum covalency to four.

Lithium's Anomalies:

    1
  1. Reactivity with Air:Unlike other alkali metals, Li forms lithium monoxide (Li2OLi_2O) with oxygen and directly reacts with nitrogen to form lithium nitride (Li3NLi_3N).
  2. 2
  3. Thermal Stability:Li2CO3Li_2CO_3 and LiNO3LiNO_3 are less thermally stable than their counterparts of other alkali metals, decomposing at lower temperatures due to Li+Li^+'s high polarizing power.
  4. 3
  5. Solubility:Lithium halides like LiClLiCl are more soluble in organic solvents, indicating covalent character.
  6. 4
  7. Diagonal Relationship:Li shows strong similarities with Magnesium (Mg), such as forming nitrides and having less soluble hydroxides.

Beryllium's Anomalies:

    1
  1. Bonding Nature:Beryllium compounds are predominantly covalent (e.g., BeCl2BeCl_2 is polymeric).
  2. 2
  3. Amphoteric Nature:BeOBeO and Be(OH)2Be(OH)_2 are amphoteric, reacting with both acids and bases.
  4. 3
  5. Maximum Covalency:Limited to four (e.g., in [BeF4]2[BeF_4]^{2-}), as it lacks d-orbitals.
  6. 4
  7. Reactivity with Water:Beryllium does not react with water or steam.
  8. 5
  9. Carbide Hydrolysis:Be2CBe_2C hydrolyzes to produce methane (CH4CH_4).
  10. 6
  11. Diagonal Relationship:Be shows strong similarities with Aluminium (Al), such as amphoteric oxides and resistance to acids due to oxide layer.

For revision, focus on comparative tables, specific reaction products, and the 'why' behind each anomaly. For instance, remember that LiNO3LiNO_3 decomposes to Li2OLi_2O, NO2NO_2, and O2O_2, while NaNO3NaNO_3 decomposes to NaNO2NaNO_2 and O2O_2. Understanding the role of polarizing power is key to explaining many of these deviations.

Prelims Revision Notes

Anomalous Properties of Lithium (Li) and Beryllium (Be)

I. General Reasons for Anomalies (Common to Li & Be):

  • Small Atomic/Ionic Size:Li+Li^+ and Be2+Be^{2+} are exceptionally small.
  • High Charge Density:(Charge/Radius ratio) is very high.
  • High Polarizing Power:Strong ability to distort electron clouds of anions, leading to covalent character.
  • High Electronegativity:Relatively higher than other group members.
  • Absence of d-orbitals:(Especially crucial for Be, limiting covalency).

II. Anomalous Properties of Lithium (Group 1):

    1
  1. Hardness & M.P./B.P.:Harder, higher M.P./B.P. than other alkali metals.
  2. 2
  3. Reaction with Oxygen:Forms monoxide (Li2OLi_2O) only. (4Li+O22Li2O4Li + O_2 \rightarrow 2Li_2O). Other alkali metals form peroxides (Na2O2Na_2O_2) or superoxides (KO2KO_2).
  4. 3
  5. Reaction with Nitrogen:Only alkali metal to react directly with N2N_2 to form nitride (Li3NLi_3N). (6Li+N22Li3N6Li + N_2 \rightarrow 2Li_3N).
  6. 4
  7. Reaction with Water:Less vigorous than other alkali metals.
  8. 5
  9. Thermal Stability of Compounds:Li2CO3Li_2CO_3 and LiNO3LiNO_3 are less stable to heat.

* Li2CO3ΔLi2O+CO2Li_2CO_3 \xrightarrow{\Delta} Li_2O + CO_2 * 2LiNO3ΔLi2O+2NO2+12O22LiNO_3 \xrightarrow{\Delta} Li_2O + 2NO_2 + \frac{1}{2}O_2 (Other nitrates form nitrite + O2O_2).

    1
  1. Solubility of Halides:LiClLiCl is soluble in organic solvents (e.g., ethanol, acetone) due to covalent character.
  2. 2
  3. Diagonal Relationship with Magnesium (Mg):

* Both form nitrides. * Both have less soluble hydroxides (LiOHLiOH, Mg(OH)2Mg(OH)_2). * Both have thermally unstable carbonates. * Both form covalent halides.

III. Anomalous Properties of Beryllium (Group 2):

    1
  1. Bonding Nature:Forms predominantly covalent compounds (e.g., BeCl2BeCl_2 is covalent and polymeric).
  2. 2
  3. Nature of Oxide/Hydroxide:BeOBeO and Be(OH)2Be(OH)_2 are amphoteric (react with both acids and bases).

* Be(OH)2+2HClBeCl2+2H2OBe(OH)_2 + 2HCl \rightarrow BeCl_2 + 2H_2O * Be(OH)2+2NaOHNa2[Be(OH)4]Be(OH)_2 + 2NaOH \rightarrow Na_2[Be(OH)_4] (Sodium beryllate)

    1
  1. Maximum Covalency:Limited to four (e.g., [BeF4]2[BeF_4]^{2-}), due to absence of d-orbitals.
  2. 2
  3. Reactivity with Water/Steam:Does not react with water or steam.
  4. 3
  5. Carbide Hydrolysis:Be2CBe_2C hydrolyzes to produce methane (CH4CH_4). (Be2C+4H2O2Be(OH)2+CH4Be_2C + 4H_2O \rightarrow 2Be(OH)_2 + CH_4).
  6. 4
  7. Diagonal Relationship with Aluminium (Al):

* Both form covalent compounds. * Both have amphoteric oxides/hydroxides. * Both form protective oxide layers (passivity). * Both react with strong alkalis to form beryllates/aluminates. * Both their carbides hydrolyze to give methane.

Vyyuha Quick Recall

LiBe's Small Size, Big Impact!

Lithium: Loves Nitrogen (nitride), Only Monoxide (with O2), Less Stable (carbonates/nitrates), Matches Magnesium (diagonal).

Beryllium: Bonds Covalently, Amphoteric Oxide, Four Covalency (max), Always Like Aluminium (diagonal).

Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.