Chemistry·Explained

Water — Explained

NEET UG
Version 1Updated 24 Mar 2026

Detailed Explanation

Water (H2OH_2O) is arguably the most vital chemical compound on Earth, underpinning all known forms of life and playing a central role in geological and atmospheric processes. Its seemingly simple molecular formula belies a complex array of properties derived from its unique molecular structure and intermolecular forces.

Conceptual Foundation: Structure and Polarity

The water molecule consists of one oxygen atom covalently bonded to two hydrogen atoms. The oxygen atom undergoes sp3sp^3 hybridization, leading to a tetrahedral electron geometry. However, due to the presence of two lone pairs of electrons on the oxygen atom, the molecular geometry is bent or V-shaped, not linear.

The ideal bond angle for sp3sp^3 hybridization is 109.5circ109.5^circ, but in water, the lone pair-lone pair repulsion and lone pair-bond pair repulsion are stronger than bond pair-bond pair repulsion, compressing the H-O-H bond angle to approximately $104.

5^circ$.

Oxygen is significantly more electronegative (3.44 on the Pauling scale) than hydrogen (2.20). This difference in electronegativity causes the shared electrons in the O-H covalent bonds to be pulled closer to the oxygen atom, creating a partial negative charge (deltadelta^-) on the oxygen and partial positive charges (delta+delta^+) on the hydrogen atoms.

Because of its bent geometry, these bond dipoles do not cancel out, resulting in a net molecular dipole moment. This makes water a highly polar molecule.

Key Principles: Hydrogen Bonding and its Consequences

The polarity of water molecules allows them to form strong intermolecular attractions called hydrogen bonds. A hydrogen bond forms when a hydrogen atom covalently bonded to a highly electronegative atom (like O, N, or F) is attracted to another electronegative atom in an adjacent molecule.

In water, each oxygen atom can form two hydrogen bonds (one with each lone pair), and each hydrogen atom can participate in one hydrogen bond. This means each water molecule can potentially form up to four hydrogen bonds with neighboring water molecules.

    1
  1. High Melting and Boiling PointsCompared to hydrides of other Group 16 elements (e.g., H2SH_2S, H2SeH_2Se), water has exceptionally high melting (0circC0^circ C) and boiling (100circC100^circ C) points. A significant amount of energy is required to overcome these strong hydrogen bonds to transition from solid to liquid and liquid to gas phases.
  2. 2
  3. High Specific Heat CapacityWater has a remarkably high specific heat capacity (4.184,J/gcircC4.184,\text{J/g}^circ C). This means it can absorb or release a large amount of heat with only a small change in its own temperature. This property is crucial for regulating Earth's climate and maintaining stable body temperatures in living organisms.
  4. 3
  5. High Latent Heats of Fusion and VaporizationSimilarly, a large amount of energy is needed to melt ice (latent heat of fusion, 334,J/g334,\text{J/g}) or vaporize liquid water (latent heat of vaporization, 2260,J/g2260,\text{J/g}). This makes water an effective coolant and helps moderate temperature changes.
  6. 4
  7. High Surface Tension and ViscosityThe strong cohesive forces due to hydrogen bonding lead to high surface tension (allowing insects to walk on water) and relatively high viscosity.
  8. 5
  9. Anomalous ExpansionUnlike most substances that contract continuously upon cooling, water contracts until 4circC4^circ C, then expands as it cools further to 0circC0^circ C and freezes. This means ice is less dense than liquid water, which is why ice floats. This property is vital for aquatic life, as ice forms on the surface of lakes and insulates the water below, preventing entire bodies of water from freezing solid.

Solvent Properties: The 'Universal Solvent'

Water's polarity and ability to form hydrogen bonds make it an excellent solvent for a wide range of substances, earning it the title 'universal solvent'.

    1
  1. Dissolving Ionic CompoundsWater molecules surround positive ions (cations) with their negatively charged oxygen ends and negative ions (anions) with their positively charged hydrogen ends. This process, called hydration, effectively separates the ions from the crystal lattice and keeps them dissolved.
  2. 2
  3. Dissolving Polar Covalent CompoundsWater can form hydrogen bonds with other polar molecules (e.g., alcohols, sugars), leading to their dissolution.
  4. 3
  5. High Dielectric ConstantWater has a very high dielectric constant (approximately 80 at 25circC25^circ C). This property reduces the electrostatic attraction between oppositely charged ions in a solution, making it easier for them to dissociate and remain dissolved.

Hardness of Water

Water is rarely found in its pure form in nature. It often contains dissolved mineral salts, primarily bicarbonates, chlorides, and sulfates of calcium (Ca2+Ca^{2+}) and magnesium (Mg2+Mg^{2+}). The presence of these dissolved salts makes water 'hard'.

Types of Hardness:

    1
  1. Temporary HardnessCaused by the presence of dissolved bicarbonates of calcium and magnesium (Ca(HCO3)2Ca(HCO_3)_2 and Mg(HCO3)2Mg(HCO_3)_2). It is called 'temporary' because it can be easily removed by boiling.

* Removal by Boiling: Heating decomposes the soluble bicarbonates into insoluble carbonates, which precipitate out.

Ca(HCO3)2(aq)xrightarrowheatCaCO3(s)downarrow+H2O(l)+CO2(g)Ca(HCO_3)_2(aq) xrightarrow{\text{heat}} CaCO_3(s) downarrow + H_2O(l) + CO_2(g)
Mg(HCO3)2(aq)xrightarrowheatMgCO3(s)downarrow+H2O(l)+CO2(g)Mg(HCO_3)_2(aq) xrightarrow{\text{heat}} MgCO_3(s) downarrow + H_2O(l) + CO_2(g)
Note: MgCO3MgCO_3 is slightly soluble, so it's often removed as Mg(OH)2Mg(OH)_2 at higher pH.

* Clark's Method: Adding a calculated amount of lime (calcium hydroxide, Ca(OH)2Ca(OH)_2) precipitates calcium carbonate and magnesium hydroxide.

    1
  1. Permanent HardnessCaused by the presence of dissolved chlorides and sulfates of calcium and magnesium (CaCl2CaCl_2, MgCl2MgCl_2, CaSO4CaSO_4, MgSO4MgSO_4). This type of hardness cannot be removed by boiling.

* Removal Methods for Permanent Hardness: * Washing Soda Method (Sodium Carbonate Method): Adding sodium carbonate (Na2CO3Na_2CO_3) precipitates calcium and magnesium ions as their carbonates.

CaCl2(aq)+Na2CO3(aq)CaCO3(s)downarrow+2NaCl(aq)CaCl_2(aq) + Na_2CO_3(aq) \rightarrow CaCO_3(s) downarrow + 2NaCl(aq)
MgSO4(aq)+Na2CO3(aq)MgCO3(s)downarrow+Na2SO4(aq)MgSO_4(aq) + Na_2CO_3(aq) \rightarrow MgCO_3(s) downarrow + Na_2SO_4(aq)
* Calgon Method (Sodium Hexametaphosphate): Sodium hexametaphosphate (Na6P6O18Na_6P_6O_{18}) forms soluble complex ions with Ca2+Ca^{2+} and Mg2+Mg^{2+} ions, effectively sequestering them and preventing them from reacting with soap.

Na6P6O182Na++Na4P6O182Na_6P_6O_{18} \rightarrow 2Na^+ + Na_4P_6O_{18}^{2-}
Na4P6O182+2Ca2+Na2[Ca2P6O18]2+2Na+Na_4P_6O_{18}^{2-} + 2Ca^{2+} \rightarrow Na_2[Ca_2P_6O_{18}]^{2-} + 2Na^+
(soluble complex) * Ion-Exchange Method (Zeolite/Permutit Process): Zeolites are hydrated sodium aluminosilicates (Na2Al2Si2O8cdotxH2ONa_2Al_2Si_2O_8 cdot xH_2O, or NaZNaZ).

Hardness-causing ions (Ca2+Ca^{2+}, Mg2+Mg^{2+}) exchange with Na+Na^+ ions in the zeolite.

2NaZ(s)+Ca2+(aq)CaZ2(s)+2Na+(aq)2NaZ(s) + Ca^{2+}(aq) \rightarrow CaZ_2(s) + 2Na^+(aq)
The exhausted zeolite can be regenerated by treating it with a concentrated NaCl solution.

CaZ2(s)+2NaCl(aq)2NaZ(s)+CaCl2(aq)CaZ_2(s) + 2NaCl(aq) \rightarrow 2NaZ(s) + CaCl_2(aq)
* Synthetic Resins Method (Deionization): This is the most effective method for producing demineralized or deionized water. It uses two types of ion-exchange resins: a cation exchange resin (containing SO3H-SO_3H groups) and an anion exchange resin (containing NH3OH-NH_3OH groups).

* Cation Exchange: Resins exchange H+H^+ ions for Ca2+Ca^{2+} and Mg2+Mg^{2+} ions.

2RSO3H(s)+Ca2+(aq)(RSO3)2Ca(s)+2H+(aq)2RSO_3H(s) + Ca^{2+}(aq) \rightarrow (RSO_3)_2Ca(s) + 2H^+(aq)
* Anion Exchange: Resins exchange OHOH^- ions for anions like ClCl^-, SO42SO_4^{2-}, HCO3HCO_3^-.

RNH3OH(s)+Cl(aq)RNH3Cl(s)+OH(aq)RNH_3OH(s) + Cl^-(aq) \rightarrow RNH_3Cl(s) + OH^-(aq)
The H+H^+ and OHOH^- ions then combine to form water, effectively removing all dissolved mineral salts.
H+(aq)+OH(aq)H2O(l)H^+(aq) + OH^-(aq) \rightarrow H_2O(l)
* Reverse Osmosis (RO): Water is forced under pressure through a semi-permeable membrane, which allows water molecules to pass but rejects dissolved salts and other impurities.

Disadvantages of Hard Water:

  • Soap WastageCa2+Ca^{2+} and Mg2+Mg^{2+} ions react with soap (sodium stearate) to form insoluble precipitates (scum), reducing lather formation and wasting soap.

2C17H35COONa(aq)+Ca2+(aq)(C17H35COO)2Ca(s)downarrow+2Na+(aq)2C_{17}H_{35}COONa(aq) + Ca^{2+}(aq) \rightarrow (C_{17}H_{35}COO)_2Ca(s) downarrow + 2Na^+(aq)

  • Scaling in BoilersHard water forms scale (e.g., CaCO3CaCO_3, Mg(OH)2Mg(OH)_2) in boilers and pipes, reducing heating efficiency, causing corrosion, and potentially leading to boiler explosions.
  • Poor TasteCan affect the taste of food and beverages.

Heavy Water ($D_2O$)

Heavy water is water in which the hydrogen atoms are replaced by deuterium (D), an isotope of hydrogen with one proton and one neutron. It is chemically similar to normal water (H2OH_2O) but has distinct physical properties due to the higher mass of deuterium.

Preparation: Primarily obtained by the prolonged electrolysis of ordinary water. Since D2OD_2O has a higher boiling point and lower vapor pressure, it concentrates in the residual liquid during electrolysis.

Properties:

  • PhysicalHigher density (1.1044,g/cm31.1044,\text{g/cm}^3 at 25circC25^circ C vs. 0.997,g/cm30.997,\text{g/cm}^3 for H2OH_2O), higher melting point (3.8circC3.8^circ C vs. 0circC0^circ C), higher boiling point (101.4circC101.4^circ C vs. 100circC100^circ C), higher viscosity, and lower dielectric constant than normal water.
  • ChemicalReactions are generally slower than those of H2OH_2O (kinetic isotope effect). It can exchange D for H in compounds containing exchangeable hydrogen atoms.

NaOH+D2ONaOD+HDONaOH + D_2O \rightarrow NaOD + HDO
CH4+D2OCH3D+HDOCH_4 + D_2O \rightarrow CH_3D + HDO
(under specific conditions)

Uses:

  • Nuclear ReactorsUsed as a moderator to slow down neutrons in nuclear reactors, allowing for sustained chain reactions.
  • Tracer CompoundUsed in studies of reaction mechanisms and metabolic pathways in biological systems.
  • NMR SpectroscopyAs a solvent in Nuclear Magnetic Resonance (NMR) spectroscopy, as deuterium nuclei do not interfere with proton NMR signals.

Chemical Reactions of Water

    1
  1. Amphoteric NatureWater can act as both an acid and a base (amphoteric).

* As an acid (donating H+H^+): H2O+NH3OH+NH4+H_2O + NH_3 \rightleftharpoons OH^- + NH_4^+ (Bronsted-Lowry acid) * As a base (accepting H+H^+): H2O+HClH3O++ClH_2O + HCl \rightleftharpoons H_3O^+ + Cl^- (Bronsted-Lowry base) * Autoionization: 2H2O(l)H3O+(aq)+OH(aq)2H_2O(l) \rightleftharpoons H_3O^+(aq) + OH^-(aq)

    1
  1. Redox ReactionsWater can be reduced by highly electropositive metals (e.g., alkali metals) and oxidized by highly electronegative elements (e.g., fluorine).

* Reduction: 2Na(s)+2H2O(l)2NaOH(aq)+H2(g)2Na(s) + 2H_2O(l) \rightarrow 2NaOH(aq) + H_2(g) * Oxidation: 2F2(g)+2H2O(l)4HF(aq)+O2(g)2F_2(g) + 2H_2O(l) \rightarrow 4HF(aq) + O_2(g)

    1
  1. Hydrolysis ReactionsWater reacts with many compounds (ionic and covalent) to break them down. Examples include hydrolysis of salts (e.g., Na2CO3Na_2CO_3, NH4ClNH_4Cl), carbides (e.g., CaC2CaC_2), nitrides, and esters.

CaC2(s)+2H2O(l)Ca(OH)2(aq)+C2H2(g)CaC_2(s) + 2H_2O(l) \rightarrow Ca(OH)_2(aq) + C_2H_2(g)
P4O10(s)+6H2O(l)4H3PO4(aq)P_4O_{10}(s) + 6H_2O(l) \rightarrow 4H_3PO_4(aq)

Common Misconceptions & NEET-Specific Angle

  • MisconceptionWater is a simple, inert molecule. Correction: Water's bent structure and hydrogen bonding make it highly reactive and crucial for many chemical and biological processes.
  • MisconceptionAll solvents behave like water. Correction: Water's high polarity and dielectric constant are unique, making it an exceptional solvent for ionic and polar compounds, unlike non-polar solvents.
  • NEET FocusQuestions often revolve around the consequences of hydrogen bonding (anomalous properties), the distinction between temporary and permanent hardness, the various methods for removing hardness (especially their chemical reactions), and the properties and uses of heavy water. Understanding the underlying chemical principles for each hardness removal method is key, as direct reaction equations are frequently tested. The amphoteric nature and hydrolysis reactions are also important conceptual areas.
Featured
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.
Ad Space
🎯PREP MANAGER
Your 6-Month Blueprint, Updated Nightly
AI analyses your progress every night. Wake up to a smarter plan. Every. Single. Day.